C19H23N3O7S2 — CID 27162235
3-(benzenesulfonamido)-N-(2-hydroxy-5-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 27162235) has the molecular formula C19H23N3O7S2 and a molecular weight of 469.54 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-(2-hydroxy-5-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | 3-(benzenesulfonamido)-N-(2-hydroxy-5-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 27162235 |
| Molecular Formula | C19H23N3O7S2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 3-(benzenesulfonamido)-N-(2-hydroxy-5-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccccc1)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1O |
| InChI | InChI=1S/C19H23N3O7S2/c23-18-7-6-16(31(27,28)22-10-12-29-13-11-22)14-17(18)21-19(24)8-9-20-30(25,26)15-4-2-1-3-5-15/h1-7,14,20,23H,8-13H2,(H,21,24) |
| InChIKey | VXLBVFNKCNHMAJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|