C19H18N2O5S2 — CID 98336656
(1R,2S,3S,4R)-3-[[2-(thiophen-2-ylsulfonylamino)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 98336656) has the molecular formula C19H18N2O5S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is (1R,2S,3S,4R)-3-[[2-(thiophen-2-ylsulfonylamino)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3S,4R)-3-[[2-(thiophen-2-ylsulfonylamino)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98336656 |
| Molecular Formula | C19H18N2O5S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | (1R,2S,3S,4R)-3-[[2-(thiophen-2-ylsulfonylamino)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](C(=O)Nc2ccccc2NS(=O)(=O)c2cccs2)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C19H18N2O5S2/c22-18(16-11-7-8-12(10-11)17(16)19(23)24)20-13-4-1-2-5-14(13)21-28(25,26)15-6-3-9-27-15/h1-9,11-12,16-17,21H,10H2,(H,20,22)(H,23,24)/t11-,12-,16-,17-/m0/s1 |
| InChIKey | IHNXFEHXSLUZHY-SYWGBEHUSA-N |
| XLogP | 3.01 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|