C8H10BrF2NO2S2 — CID 107492734
N-(2-bromoethyl)-N-(2,2-difluoroethyl)thiophene-2-sulfonamide (PubChem CID 107492734) has the molecular formula C8H10BrF2NO2S2 and a molecular weight of 334.21 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)thiophene-2-sulfonamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 107492734 |
| Molecular Formula | C8H10BrF2NO2S2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 332.93 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(c1cccs1)N(CCBr)CC(F)F |
| InChI | InChI=1S/C8H10BrF2NO2S2/c9-3-4-12(6-7(10)11)16(13,14)8-2-1-5-15-8/h1-2,5,7H,3-4,6H2 |
| InChIKey | BSIGNFVXWVPQQQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|