C17H18N2O3S2 — CID 89145708
N-ethyl-N-(2-formyl-4,5-dimethyl-1H-indol-7-yl)thiophene-2-sulfonamide (PubChem CID 89145708) has the molecular formula C17H18N2O3S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is N-ethyl-N-(2-formyl-4,5-dimethyl-1H-indol-7-yl)thiophene-2-sulfonamide.
| Compound Name | N-ethyl-N-(2-formyl-4,5-dimethyl-1H-indol-7-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 89145708 |
| Molecular Formula | C17H18N2O3S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | N-ethyl-N-(2-formyl-4,5-dimethyl-1H-indol-7-yl)thiophene-2-sulfonamide |
| SMILES | CCN(c1cc(C)c(C)c2cc(C=O)[nH]c12)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H18N2O3S2/c1-4-19(24(21,22)16-6-5-7-23-16)15-8-11(2)12(3)14-9-13(10-20)18-17(14)15/h5-10,18H,4H2,1-3H3 |
| InChIKey | JWYBXWRAPDHWTE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|