C19H18ClN3O2S3 — CID 59135733
N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-4-methyl-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide (PubChem CID 59135733) has the molecular formula C19H18ClN3O2S3 and a molecular weight of 452.03 g/mol. Its IUPAC name is N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-4-methyl-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide.
| Compound Name | N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-4-methyl-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 59135733 |
| Molecular Formula | C19H18ClN3O2S3 |
| Molecular Weight | 452.03 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-4-methyl-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide |
| SMILES | CCN(c1ccc(C)c2cc(-c3ncc(CCl)s3)[nH]c12)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H18ClN3O2S3/c1-3-23(28(24,25)17-5-4-8-26-17)16-7-6-12(2)14-9-15(22-18(14)16)19-21-11-13(10-20)27-19/h4-9,11,22H,3,10H2,1-2H3 |
| InChIKey | UQDWLANFBQSZID-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.03 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|