C18H16ClN3O2S3 — CID 68667159
N-[1-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]ethyl]thiophene-2-sulfonamide (PubChem CID 68667159) has the molecular formula C18H16ClN3O2S3 and a molecular weight of 438.00 g/mol. Its IUPAC name is N-[1-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[1-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 68667159 |
| Molecular Formula | C18H16ClN3O2S3 |
| Molecular Weight | 438.00 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | N-[1-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]ethyl]thiophene-2-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cccs1)c1cccc2cc(-c3ncc(CCl)s3)[nH]c12 |
| InChI | InChI=1S/C18H16ClN3O2S3/c1-11(22-27(23,24)16-6-3-7-25-16)14-5-2-4-12-8-15(21-17(12)14)18-20-10-13(9-19)26-18/h2-8,10-11,21-22H,9H2,1H3 |
| InChIKey | WCIWMIVXZGSOFJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.00 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|