C18H17N3O2S4 — CID 126635143
N-methyl-2-[5-(methylsulfonylmethyl)-1,3-thiazol-2-yl]-N-thiophen-2-ylsulfanyl-1H-indol-7-amine (PubChem CID 126635143) has the molecular formula C18H17N3O2S4 and a molecular weight of 435.62 g/mol. Its IUPAC name is N-methyl-2-[5-(methylsulfonylmethyl)-1,3-thiazol-2-yl]-N-thiophen-2-ylsulfanyl-1H-indol-7-amine.
| Compound Name | N-methyl-2-[5-(methylsulfonylmethyl)-1,3-thiazol-2-yl]-N-thiophen-2-ylsulfanyl-1H-indol-7-amine |
|---|---|
| PubChem CID | 126635143 |
| Molecular Formula | C18H17N3O2S4 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | N-methyl-2-[5-(methylsulfonylmethyl)-1,3-thiazol-2-yl]-N-thiophen-2-ylsulfanyl-1H-indol-7-amine |
| SMILES | CN(Sc1cccs1)c1cccc2cc(-c3ncc(CS(C)(=O)=O)s3)[nH]c12 |
| InChI | InChI=1S/C18H17N3O2S4/c1-21(26-16-7-4-8-24-16)15-6-3-5-12-9-14(20-17(12)15)18-19-10-13(25-18)11-27(2,22)23/h3-10,20H,11H2,1-2H3 |
| InChIKey | GOGWFXQOBFCVMT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|