C17H15N3OS3 — CID 126635131
[2-[7-[methyl(thiophen-2-ylsulfanyl)amino]-1H-indol-2-yl]-1,3-thiazol-5-yl]methanol (PubChem CID 126635131) has the molecular formula C17H15N3OS3 and a molecular weight of 373.53 g/mol. Its IUPAC name is [2-[7-[methyl(thiophen-2-ylsulfanyl)amino]-1H-indol-2-yl]-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-[7-[methyl(thiophen-2-ylsulfanyl)amino]-1H-indol-2-yl]-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 126635131 |
| Molecular Formula | C17H15N3OS3 |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | [2-[7-[methyl(thiophen-2-ylsulfanyl)amino]-1H-indol-2-yl]-1,3-thiazol-5-yl]methanol |
| SMILES | CN(Sc1cccs1)c1cccc2cc(-c3ncc(CO)s3)[nH]c12 |
| InChI | InChI=1S/C17H15N3OS3/c1-20(24-15-6-3-7-22-15)14-5-2-4-11-8-13(19-16(11)14)17-18-9-12(10-21)23-17/h2-9,19,21H,10H2,1H3 |
| InChIKey | MNNCSRZXGADPBA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|