C18H17N3OS3 — CID 143310720
N-hydroxysulfanyl-2-(5-propyl-1,3-thiazol-2-yl)-N-thiophen-2-yl-1H-indol-7-amine (PubChem CID 143310720) has the molecular formula C18H17N3OS3 and a molecular weight of 387.56 g/mol. Its IUPAC name is N-hydroxysulfanyl-2-(5-propyl-1,3-thiazol-2-yl)-N-thiophen-2-yl-1H-indol-7-amine.
| Compound Name | N-hydroxysulfanyl-2-(5-propyl-1,3-thiazol-2-yl)-N-thiophen-2-yl-1H-indol-7-amine |
|---|---|
| PubChem CID | 143310720 |
| Molecular Formula | C18H17N3OS3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | N-hydroxysulfanyl-2-(5-propyl-1,3-thiazol-2-yl)-N-thiophen-2-yl-1H-indol-7-amine |
| SMILES | CCCc1cnc(-c2cc3cccc(N(SO)c4cccs4)c3[nH]2)s1 |
| InChI | InChI=1S/C18H17N3OS3/c1-2-5-13-11-19-18(24-13)14-10-12-6-3-7-15(17(12)20-14)21(25-22)16-8-4-9-23-16/h3-4,6-11,20,22H,2,5H2,1H3 |
| InChIKey | SAKAAFYRARMPOX-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|