C19H18N4OS4 — CID 126635053
2-[[2-[7-[methyl(thiophen-2-ylsulfanyl)amino]-1H-indol-2-yl]-1,3-thiazol-5-yl]methylsulfanyl]acetamide (PubChem CID 126635053) has the molecular formula C19H18N4OS4 and a molecular weight of 446.65 g/mol. Its IUPAC name is 2-[[2-[7-[methyl(thiophen-2-ylsulfanyl)amino]-1H-indol-2-yl]-1,3-thiazol-5-yl]methylsulfanyl]acetamide.
| Compound Name | 2-[[2-[7-[methyl(thiophen-2-ylsulfanyl)amino]-1H-indol-2-yl]-1,3-thiazol-5-yl]methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 126635053 |
| Molecular Formula | C19H18N4OS4 |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 2-[[2-[7-[methyl(thiophen-2-ylsulfanyl)amino]-1H-indol-2-yl]-1,3-thiazol-5-yl]methylsulfanyl]acetamide |
| SMILES | CN(Sc1cccs1)c1cccc2cc(-c3ncc(CSCC(N)=O)s3)[nH]c12 |
| InChI | InChI=1S/C19H18N4OS4/c1-23(28-17-6-3-7-26-17)15-5-2-4-12-8-14(22-18(12)15)19-21-9-13(27-19)10-25-11-16(20)24/h2-9,22H,10-11H2,1H3,(H2,20,24) |
| InChIKey | UFCMDBHJUWJWCR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|