C20H23N3OS4 — CID 143660888
N-methyl-2-[5-methyl-5-(2-methylsulfanyloxyethyl)-4H-1,3-thiazol-2-yl]-N-thiophen-2-ylsulfanyl-1H-indol-7-amine (PubChem CID 143660888) has the molecular formula C20H23N3OS4 and a molecular weight of 449.69 g/mol. Its IUPAC name is N-methyl-2-[5-methyl-5-(2-methylsulfanyloxyethyl)-4H-1,3-thiazol-2-yl]-N-thiophen-2-ylsulfanyl-1H-indol-7-amine.
| Compound Name | N-methyl-2-[5-methyl-5-(2-methylsulfanyloxyethyl)-4H-1,3-thiazol-2-yl]-N-thiophen-2-ylsulfanyl-1H-indol-7-amine |
|---|---|
| PubChem CID | 143660888 |
| Molecular Formula | C20H23N3OS4 |
| Molecular Weight | 449.69 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | N-methyl-2-[5-methyl-5-(2-methylsulfanyloxyethyl)-4H-1,3-thiazol-2-yl]-N-thiophen-2-ylsulfanyl-1H-indol-7-amine |
| SMILES | CSOCCC1(C)CN=C(c2cc3cccc(N(C)Sc4cccs4)c3[nH]2)S1 |
| InChI | InChI=1S/C20H23N3OS4/c1-20(9-10-24-25-3)13-21-19(27-20)15-12-14-6-4-7-16(18(14)22-15)23(2)28-17-8-5-11-26-17/h4-8,11-12,22H,9-10,13H2,1-3H3 |
| InChIKey | YKFIMMVFJTVVQQ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.69 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|