C15H15N3S3 — CID 126635029
7-[ethyl(thiophen-2-ylsulfanyl)amino]-1H-indole-2-carbothioamide (PubChem CID 126635029) has the molecular formula C15H15N3S3 and a molecular weight of 333.51 g/mol. Its IUPAC name is 7-[ethyl(thiophen-2-ylsulfanyl)amino]-1H-indole-2-carbothioamide.
| Compound Name | 7-[ethyl(thiophen-2-ylsulfanyl)amino]-1H-indole-2-carbothioamide |
|---|---|
| PubChem CID | 126635029 |
| Molecular Formula | C15H15N3S3 |
| Molecular Weight | 333.51 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 7-[ethyl(thiophen-2-ylsulfanyl)amino]-1H-indole-2-carbothioamide |
| SMILES | CCN(Sc1cccs1)c1cccc2cc(C(N)=S)[nH]c12 |
| InChI | InChI=1S/C15H15N3S3/c1-2-18(21-13-7-4-8-20-13)12-6-3-5-10-9-11(15(16)19)17-14(10)12/h3-9,17H,2H2,1H3,(H2,16,19) |
| InChIKey | HRBSTGUAJPINLQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|