C22H24N4O2S4 — CID 126634824
2-[[2-[7-[2-ethoxyethyl(thiophen-2-ylsulfanyl)amino]-1H-indol-2-yl]-1,3-thiazol-5-yl]methylsulfanyl]acetamide (PubChem CID 126634824) has the molecular formula C22H24N4O2S4 and a molecular weight of 504.73 g/mol. Its IUPAC name is 2-[[2-[7-[2-ethoxyethyl(thiophen-2-ylsulfanyl)amino]-1H-indol-2-yl]-1,3-thiazol-5-yl]methylsulfanyl]acetamide.
| Compound Name | 2-[[2-[7-[2-ethoxyethyl(thiophen-2-ylsulfanyl)amino]-1H-indol-2-yl]-1,3-thiazol-5-yl]methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 126634824 |
| Molecular Formula | C22H24N4O2S4 |
| Molecular Weight | 504.73 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 2-[[2-[7-[2-ethoxyethyl(thiophen-2-ylsulfanyl)amino]-1H-indol-2-yl]-1,3-thiazol-5-yl]methylsulfanyl]acetamide |
| SMILES | CCOCCN(Sc1cccs1)c1cccc2cc(-c3ncc(CSCC(N)=O)s3)[nH]c12 |
| InChI | InChI=1S/C22H24N4O2S4/c1-2-28-9-8-26(32-20-7-4-10-30-20)18-6-3-5-15-11-17(25-21(15)18)22-24-12-16(31-22)13-29-14-19(23)27/h3-7,10-12,25H,2,8-9,13-14H2,1H3,(H2,23,27) |
| InChIKey | YNZNAQMTVBXUJK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.73 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|