C19H18N4O2S2 — CID 143660915
2-[2-[7-[methyl(pyridin-2-ylsulfanyl)amino]-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-5-yl]acetic acid (PubChem CID 143660915) has the molecular formula C19H18N4O2S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[2-[7-[methyl(pyridin-2-ylsulfanyl)amino]-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[2-[7-[methyl(pyridin-2-ylsulfanyl)amino]-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 143660915 |
| Molecular Formula | C19H18N4O2S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-[2-[7-[methyl(pyridin-2-ylsulfanyl)amino]-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-5-yl]acetic acid |
| SMILES | CN(Sc1ccccn1)c1cccc2cc(C3=NCC(CC(=O)O)S3)[nH]c12 |
| InChI | InChI=1S/C19H18N4O2S2/c1-23(27-16-7-2-3-8-20-16)15-6-4-5-12-9-14(22-18(12)15)19-21-11-13(26-19)10-17(24)25/h2-9,13,22H,10-11H2,1H3,(H,24,25) |
| InChIKey | AILOQKRDHPNBPW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|