C24H32N6S2 — CID 143660797
ethane;N'-[[2-[7-[methyl(pyridin-2-ylsulfanyl)amino]-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-5-yl]methyl]-N-propylmethanimidamide (PubChem CID 143660797) has the molecular formula C24H32N6S2 and a molecular weight of 468.70 g/mol. Its IUPAC name is ethane;N'-[[2-[7-[methyl(pyridin-2-ylsulfanyl)amino]-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-5-yl]methyl]-N-propylmethanimidamide.
| Compound Name | ethane;N'-[[2-[7-[methyl(pyridin-2-ylsulfanyl)amino]-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-5-yl]methyl]-N-propylmethanimidamide |
|---|---|
| PubChem CID | 143660797 |
| Molecular Formula | C24H32N6S2 |
| Molecular Weight | 468.70 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | ethane;N'-[[2-[7-[methyl(pyridin-2-ylsulfanyl)amino]-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-5-yl]methyl]-N-propylmethanimidamide |
| SMILES | CC.CCCN/C=N/CC1CN=C(c2cc3cccc(N(C)Sc4ccccn4)c3[nH]2)S1 |
| InChI | InChI=1S/C22H26N6S2.C2H6/c1-3-10-23-15-24-13-17-14-26-22(29-17)18-12-16-7-6-8-19(21(16)27-18)28(2)30-20-9-4-5-11-25-20;1-2/h4-9,11-12,15,17,27H,3,10,13-14H2,1-2H3,(H,23,24);1-2H3 |
| InChIKey | ULBAVFWTTWJJNG-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 68.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.70 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|