C15H13N3S3 — CID 126635023
2-(4,5-dihydro-1,3-thiazol-2-yl)-N-thiophen-2-ylsulfanyl-1H-indol-7-amine (PubChem CID 126635023) has the molecular formula C15H13N3S3 and a molecular weight of 331.49 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-thiazol-2-yl)-N-thiophen-2-ylsulfanyl-1H-indol-7-amine.
| Compound Name | 2-(4,5-dihydro-1,3-thiazol-2-yl)-N-thiophen-2-ylsulfanyl-1H-indol-7-amine |
|---|---|
| PubChem CID | 126635023 |
| Molecular Formula | C15H13N3S3 |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-(4,5-dihydro-1,3-thiazol-2-yl)-N-thiophen-2-ylsulfanyl-1H-indol-7-amine |
| SMILES | c1csc(SNc2cccc3cc(C4=NCCS4)[nH]c23)c1 |
| InChI | InChI=1S/C15H13N3S3/c1-3-10-9-12(15-16-6-8-20-15)17-14(10)11(4-1)18-21-13-5-2-7-19-13/h1-5,7,9,17-18H,6,8H2 |
| InChIKey | WCERUROTXSBAOV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|