C17H17N3S3 — CID 126634922
2-(4,5-dihydro-1,3-thiazol-2-yl)-N-(2,5-dimethylthiophen-3-yl)sulfanyl-1H-indol-7-amine (PubChem CID 126634922) has the molecular formula C17H17N3S3 and a molecular weight of 359.55 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-thiazol-2-yl)-N-(2,5-dimethylthiophen-3-yl)sulfanyl-1H-indol-7-amine.
| Compound Name | 2-(4,5-dihydro-1,3-thiazol-2-yl)-N-(2,5-dimethylthiophen-3-yl)sulfanyl-1H-indol-7-amine |
|---|---|
| PubChem CID | 126634922 |
| Molecular Formula | C17H17N3S3 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 2-(4,5-dihydro-1,3-thiazol-2-yl)-N-(2,5-dimethylthiophen-3-yl)sulfanyl-1H-indol-7-amine |
| SMILES | Cc1cc(SNc2cccc3cc(C4=NCCS4)[nH]c23)c(C)s1 |
| InChI | InChI=1S/C17H17N3S3/c1-10-8-15(11(2)22-10)23-20-13-5-3-4-12-9-14(19-16(12)13)17-18-6-7-21-17/h3-5,8-9,19-20H,6-7H2,1-2H3 |
| InChIKey | XVNMMSHSHVEGAE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|