C10H11NS — CID 3024542
2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole (PubChem CID 3024542) has the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. Its IUPAC name is 2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 3024542 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole |
| SMILES | Cc1cccc(C2=NCCS2)c1 |
| InChI | InChI=1S/C10H11NS/c1-8-3-2-4-9(7-8)10-11-5-6-12-10/h2-4,7H,5-6H2,1H3 |
| InChIKey | YNVRQNBVGXXWMT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |