About 2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole
2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole (PubChem CID 3024542) has the molecular formula C10H11NS
and a molecular weight of 177.27 g/mol. Its IUPAC name is 2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole |
| PubChem CID | 3024542 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole |
| SMILES | Cc1cccc(C2=NCCS2)c1 |
| InChI | InChI=1S/C10H11NS/c1-8-3-2-4-9(7-8)10-11-5-6-12-10/h2-4,7H,5-6H2,1H3 |
| InChIKey | YNVRQNBVGXXWMT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole?
The IUPAC name of 2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole (CID 3024542) is 2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for 2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole?
The canonical SMILES for 2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole is Cc1cccc(C2=NCCS2)c1.
What is the InChIKey of 2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole?
The InChIKey is YNVRQNBVGXXWMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NS/c1-8-3-2-4-9(7-8)10-11-5-6-12-10/h2-4,7H,5-6H2,1H3.
What are the key properties of 2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole?
2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole has a molecular weight of 177.27 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylphenyl)-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 3024542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).