C11H11N3S2 — CID 13356050
2-(methylamino)-6-(3-methylphenyl)-1,3,5-thiadiazine-4-thione (PubChem CID 13356050) has the molecular formula C11H11N3S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-(methylamino)-6-(3-methylphenyl)-1,3,5-thiadiazine-4-thione.
| Compound Name | 2-(methylamino)-6-(3-methylphenyl)-1,3,5-thiadiazine-4-thione |
|---|---|
| PubChem CID | 13356050 |
| Molecular Formula | C11H11N3S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 2-(methylamino)-6-(3-methylphenyl)-1,3,5-thiadiazine-4-thione |
| SMILES | CNc1nc(=S)nc(-c2cccc(C)c2)s1 |
| InChI | InChI=1S/C11H11N3S2/c1-7-4-3-5-8(6-7)9-13-10(15)14-11(12-2)16-9/h3-6H,1-2H3,(H,12,14,15) |
| InChIKey | CDTMVPIUDYHOCS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|