C9H11ClN4S — CID 45263058
[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride (PubChem CID 45263058) has the molecular formula C9H11ClN4S and a molecular weight of 242.74 g/mol. Its IUPAC name is [5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride.
| Compound Name | [5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride |
|---|---|
| PubChem CID | 45263058 |
| Molecular Formula | C9H11ClN4S |
| Molecular Weight | 242.74 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | [5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride |
| SMILES | Cc1cccc(-c2nnc(NN)s2)c1.Cl |
| InChI | InChI=1S/C9H10N4S.ClH/c1-6-3-2-4-7(5-6)8-12-13-9(11-10)14-8;/h2-5H,10H2,1H3,(H,11,13);1H |
| InChIKey | CBEHJVRBNMQLIF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.74 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|