C16H13N3S3 — CID 143310673
2-(1,3-thiazol-2-yl)-N-(2H-thiopyran-6-ylsulfanyl)-1H-indol-7-amine (PubChem CID 143310673) has the molecular formula C16H13N3S3 and a molecular weight of 343.50 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yl)-N-(2H-thiopyran-6-ylsulfanyl)-1H-indol-7-amine.
| Compound Name | 2-(1,3-thiazol-2-yl)-N-(2H-thiopyran-6-ylsulfanyl)-1H-indol-7-amine |
|---|---|
| PubChem CID | 143310673 |
| Molecular Formula | C16H13N3S3 |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 2-(1,3-thiazol-2-yl)-N-(2H-thiopyran-6-ylsulfanyl)-1H-indol-7-amine |
| SMILES | C1=CCSC(SNc2cccc3cc(-c4nccs4)[nH]c23)=C1 |
| InChI | InChI=1S/C16H13N3S3/c1-2-8-20-14(6-1)22-19-12-5-3-4-11-10-13(18-15(11)12)16-17-7-9-21-16/h1-7,9-10,18-19H,8H2 |
| InChIKey | WEEHBJYNKWINHP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|