C23H27N5OS3 — CID 126635156
N-methyl-N-[2-[(2-morpholin-4-ylethylamino)methyl]thiophen-3-yl]sulfanyl-2-(1,3-thiazol-2-yl)-1H-indol-7-amine (PubChem CID 126635156) has the molecular formula C23H27N5OS3 and a molecular weight of 485.70 g/mol. Its IUPAC name is N-methyl-N-[2-[(2-morpholin-4-ylethylamino)methyl]thiophen-3-yl]sulfanyl-2-(1,3-thiazol-2-yl)-1H-indol-7-amine.
| Compound Name | N-methyl-N-[2-[(2-morpholin-4-ylethylamino)methyl]thiophen-3-yl]sulfanyl-2-(1,3-thiazol-2-yl)-1H-indol-7-amine |
|---|---|
| PubChem CID | 126635156 |
| Molecular Formula | C23H27N5OS3 |
| Molecular Weight | 485.70 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | N-methyl-N-[2-[(2-morpholin-4-ylethylamino)methyl]thiophen-3-yl]sulfanyl-2-(1,3-thiazol-2-yl)-1H-indol-7-amine |
| SMILES | CN(Sc1ccsc1CNCCN1CCOCC1)c1cccc2cc(-c3nccs3)[nH]c12 |
| InChI | InChI=1S/C23H27N5OS3/c1-27(19-4-2-3-17-15-18(26-22(17)19)23-25-7-14-31-23)32-20-5-13-30-21(20)16-24-6-8-28-9-11-29-12-10-28/h2-5,7,13-15,24,26H,6,8-12,16H2,1H3 |
| InChIKey | VQVYFQYQURBTCN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 56.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|