C16H20N4O2S — CID 60545810
1-(2-morpholin-4-ylethyl)-3-[3-(1,3-thiazol-2-yl)phenyl]urea (PubChem CID 60545810) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-3-[3-(1,3-thiazol-2-yl)phenyl]urea.
| Compound Name | 1-(2-morpholin-4-ylethyl)-3-[3-(1,3-thiazol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 60545810 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-3-[3-(1,3-thiazol-2-yl)phenyl]urea |
| SMILES | O=C(NCCN1CCOCC1)Nc1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C16H20N4O2S/c21-16(18-4-6-20-7-9-22-10-8-20)19-14-3-1-2-13(12-14)15-17-5-11-23-15/h1-3,5,11-12H,4,6-10H2,(H2,18,19,21) |
| InChIKey | JWJIDEYHFUHTSM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |