C16H17N5O2S — CID 87044600
1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[3-(1,3-thiazol-2-yl)phenyl]urea (PubChem CID 87044600) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is 1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[3-(1,3-thiazol-2-yl)phenyl]urea.
| Compound Name | 1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[3-(1,3-thiazol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 87044600 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[3-(1,3-thiazol-2-yl)phenyl]urea |
| SMILES | COCCn1cc(NC(=O)Nc2cccc(-c3nccs3)c2)cn1 |
| InChI | InChI=1S/C16H17N5O2S/c1-23-7-6-21-11-14(10-18-21)20-16(22)19-13-4-2-3-12(9-13)15-17-5-8-24-15/h2-5,8-11H,6-7H2,1H3,(H2,19,20,22) |
| InChIKey | FXSYTLMOOXPYRN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |