C15H15N3OS — CID 28732154
2-[3-[1-(2-methoxyethyl)pyrazol-3-yl]phenyl]-1,3-thiazole (PubChem CID 28732154) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-[3-[1-(2-methoxyethyl)pyrazol-3-yl]phenyl]-1,3-thiazole.
| Compound Name | 2-[3-[1-(2-methoxyethyl)pyrazol-3-yl]phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 28732154 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-[3-[1-(2-methoxyethyl)pyrazol-3-yl]phenyl]-1,3-thiazole |
| SMILES | COCCn1ccc(-c2cccc(-c3nccs3)c2)n1 |
| InChI | InChI=1S/C15H15N3OS/c1-19-9-8-18-7-5-14(17-18)12-3-2-4-13(11-12)15-16-6-10-20-15/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | LLSYWZMHPBJCGI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |