C17H13N3O2S3 — CID 126635145
3-[methyl-[2-(1,3-thiazol-2-yl)-1H-indol-7-yl]amino]sulfanylthiophene-2-carboxylic acid (PubChem CID 126635145) has the molecular formula C17H13N3O2S3 and a molecular weight of 387.51 g/mol. Its IUPAC name is 3-[methyl-[2-(1,3-thiazol-2-yl)-1H-indol-7-yl]amino]sulfanylthiophene-2-carboxylic acid.
| Compound Name | 3-[methyl-[2-(1,3-thiazol-2-yl)-1H-indol-7-yl]amino]sulfanylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 126635145 |
| Molecular Formula | C17H13N3O2S3 |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 3-[methyl-[2-(1,3-thiazol-2-yl)-1H-indol-7-yl]amino]sulfanylthiophene-2-carboxylic acid |
| SMILES | CN(Sc1ccsc1C(=O)O)c1cccc2cc(-c3nccs3)[nH]c12 |
| InChI | InChI=1S/C17H13N3O2S3/c1-20(25-13-5-7-23-15(13)17(21)22)12-4-2-3-10-9-11(19-14(10)12)16-18-6-8-24-16/h2-9,19H,1H3,(H,21,22) |
| InChIKey | WWMUQRZHNTYXEI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|