C15H14N2O2S2 — CID 143310711
7-[methyl-(5-methylthiophen-2-yl)sulfanylamino]-1H-indole-2-carboxylic acid (PubChem CID 143310711) has the molecular formula C15H14N2O2S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 7-[methyl-(5-methylthiophen-2-yl)sulfanylamino]-1H-indole-2-carboxylic acid.
| Compound Name | 7-[methyl-(5-methylthiophen-2-yl)sulfanylamino]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 143310711 |
| Molecular Formula | C15H14N2O2S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 7-[methyl-(5-methylthiophen-2-yl)sulfanylamino]-1H-indole-2-carboxylic acid |
| SMILES | Cc1ccc(SN(C)c2cccc3cc(C(=O)O)[nH]c23)s1 |
| InChI | InChI=1S/C15H14N2O2S2/c1-9-6-7-13(20-9)21-17(2)12-5-3-4-10-8-11(15(18)19)16-14(10)12/h3-8,16H,1-2H3,(H,18,19) |
| InChIKey | ULZLIVJRUUBMTP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|