C21H21F3N2O5S — CID 2444981
methyl 4-[[[2-[prop-2-enyl-[2-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]methyl]benzoate (PubChem CID 2444981) has the molecular formula C21H21F3N2O5S and a molecular weight of 470.47 g/mol. Its IUPAC name is methyl 4-[[[2-[prop-2-enyl-[2-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-[prop-2-enyl-[2-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 2444981 |
| Molecular Formula | C21H21F3N2O5S |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | methyl 4-[[[2-[prop-2-enyl-[2-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]methyl]benzoate |
| SMILES | C=CCN(CC(=O)NCc1ccc(C(=O)OC)cc1)S(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H21F3N2O5S/c1-3-12-26(32(29,30)18-7-5-4-6-17(18)21(22,23)24)14-19(27)25-13-15-8-10-16(11-9-15)20(28)31-2/h3-11H,1,12-14H2,2H3,(H,25,27) |
| InChIKey | XIPQVOXDTYENSX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|