C11H13NO6S2 — CID 79264091
2-[(2-methoxycarbonylthiophen-3-yl)sulfonyl-prop-2-enylamino]acetic acid (PubChem CID 79264091) has the molecular formula C11H13NO6S2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-[(2-methoxycarbonylthiophen-3-yl)sulfonyl-prop-2-enylamino]acetic acid.
| Compound Name | 2-[(2-methoxycarbonylthiophen-3-yl)sulfonyl-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79264091 |
| Molecular Formula | C11H13NO6S2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 2-[(2-methoxycarbonylthiophen-3-yl)sulfonyl-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)S(=O)(=O)c1ccsc1C(=O)OC |
| InChI | InChI=1S/C11H13NO6S2/c1-3-5-12(7-9(13)14)20(16,17)8-4-6-19-10(8)11(15)18-2/h3-4,6H,1,5,7H2,2H3,(H,13,14) |
| InChIKey | JUFSWVSFLMYUDP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|