C13H17NO6S2 — CID 95161365
methyl 3-[[(2S)-2-but-3-enoxypropanoyl]sulfamoyl]thiophene-2-carboxylate (PubChem CID 95161365) has the molecular formula C13H17NO6S2 and a molecular weight of 347.41 g/mol. Its IUPAC name is methyl 3-[[(2S)-2-but-3-enoxypropanoyl]sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[(2S)-2-but-3-enoxypropanoyl]sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 95161365 |
| Molecular Formula | C13H17NO6S2 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | methyl 3-[[(2S)-2-but-3-enoxypropanoyl]sulfamoyl]thiophene-2-carboxylate |
| SMILES | C=CCCO[C@@H](C)C(=O)NS(=O)(=O)c1ccsc1C(=O)OC |
| InChI | InChI=1S/C13H17NO6S2/c1-4-5-7-20-9(2)12(15)14-22(17,18)10-6-8-21-11(10)13(16)19-3/h4,6,8-9H,1,5,7H2,2-3H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | UEXFWYFNCKOGBP-VIFPVBQESA-N |
| XLogP | 1.32 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|