C13H18FNO2S — CID 107327365
N-ethyl-4-fluoro-2,6-dimethyl-N-prop-2-enylbenzenesulfonamide (PubChem CID 107327365) has the molecular formula C13H18FNO2S and a molecular weight of 271.36 g/mol. Its IUPAC name is N-ethyl-4-fluoro-2,6-dimethyl-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-ethyl-4-fluoro-2,6-dimethyl-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 107327365 |
| Molecular Formula | C13H18FNO2S |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-ethyl-4-fluoro-2,6-dimethyl-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(CC)S(=O)(=O)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C13H18FNO2S/c1-5-7-15(6-2)18(16,17)13-10(3)8-12(14)9-11(13)4/h5,8-9H,1,6-7H2,2-4H3 |
| InChIKey | FLWDMMYZMFWEIS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|