C24H32N2O7S — CID 19774292
benzyl-[2-(cyclohexanecarbonyloxy)ethyl]-dimethylazanium;3-nitrobenzenesulfonate (PubChem CID 19774292) has the molecular formula C24H32N2O7S and a molecular weight of 492.59 g/mol. Its IUPAC name is benzyl-[2-(cyclohexanecarbonyloxy)ethyl]-dimethylazanium;3-nitrobenzenesulfonate.
| Compound Name | benzyl-[2-(cyclohexanecarbonyloxy)ethyl]-dimethylazanium;3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 19774292 |
| Molecular Formula | C24H32N2O7S |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | benzyl-[2-(cyclohexanecarbonyloxy)ethyl]-dimethylazanium;3-nitrobenzenesulfonate |
| SMILES | C[N+](C)(CCOC(=O)C1CCCCC1)Cc1ccccc1.O=[N+]([O-])c1cccc(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C18H28NO2.C6H5NO5S/c1-19(2,15-16-9-5-3-6-10-16)13-14-21-18(20)17-11-7-4-8-12-17;8-7(9)5-2-1-3-6(4-5)13(10,11)12/h3,5-6,9-10,17H,4,7-8,11-15H2,1-2H3;1-4H,(H,10,11,12)/q+1;/p-1 |
| InChIKey | FHIDNVYTWJOWRJ-UHFFFAOYSA-M |
| XLogP | 3.89 |
| TPSA | 126.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|