C21H19N3O4S — CID 167929946
N-(1,3-diphenylpropan-2-ylideneamino)-3-nitrobenzenesulfonamide (PubChem CID 167929946) has the molecular formula C21H19N3O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is N-(1,3-diphenylpropan-2-ylideneamino)-3-nitrobenzenesulfonamide.
| Compound Name | N-(1,3-diphenylpropan-2-ylideneamino)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 167929946 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N-(1,3-diphenylpropan-2-ylideneamino)-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)NN=C(Cc2ccccc2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H19N3O4S/c25-24(26)20-12-7-13-21(16-20)29(27,28)23-22-19(14-17-8-3-1-4-9-17)15-18-10-5-2-6-11-18/h1-13,16,23H,14-15H2 |
| InChIKey | XUVCSFAKOXBPEF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|