C20H23N3O5S — CID 69440585
6-methyl-1-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]-2,4-dihydro-3,1-benzoxazine (PubChem CID 69440585) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is 6-methyl-1-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]-2,4-dihydro-3,1-benzoxazine.
| Compound Name | 6-methyl-1-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]-2,4-dihydro-3,1-benzoxazine |
|---|---|
| PubChem CID | 69440585 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 6-methyl-1-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]-2,4-dihydro-3,1-benzoxazine |
| SMILES | Cc1ccc2c(c1)COCN2C1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C20H23N3O5S/c1-15-5-6-20-16(11-15)13-28-14-22(20)17-7-9-21(10-8-17)29(26,27)19-4-2-3-18(12-19)23(24)25/h2-6,11-12,17H,7-10,13-14H2,1H3 |
| InChIKey | FEPUTRMGEAZQFB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|