C21H23N3O6S — CID 58792849
6-methyl-1-[1-(2-methyl-5-nitrophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one (PubChem CID 58792849) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is 6-methyl-1-[1-(2-methyl-5-nitrophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one.
| Compound Name | 6-methyl-1-[1-(2-methyl-5-nitrophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 58792849 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 6-methyl-1-[1-(2-methyl-5-nitrophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one |
| SMILES | Cc1ccc2c(c1)COC(=O)N2C1CCN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2C)CC1 |
| InChI | InChI=1S/C21H23N3O6S/c1-14-3-6-19-16(11-14)13-30-21(25)23(19)17-7-9-22(10-8-17)31(28,29)20-12-18(24(26)27)5-4-15(20)2/h3-6,11-12,17H,7-10,13H2,1-2H3 |
| InChIKey | AVJJYKUYQXGPNO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|