C26H25IN2O5S — CID 142998583
1-[1-[4-(4-iodophenoxy)phenyl]sulfonylpiperidin-4-yl]-6-methyl-4H-3,1-benzoxazin-2-one (PubChem CID 142998583) has the molecular formula C26H25IN2O5S and a molecular weight of 604.47 g/mol. Its IUPAC name is 1-[1-[4-(4-iodophenoxy)phenyl]sulfonylpiperidin-4-yl]-6-methyl-4H-3,1-benzoxazin-2-one.
| Compound Name | 1-[1-[4-(4-iodophenoxy)phenyl]sulfonylpiperidin-4-yl]-6-methyl-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 142998583 |
| Molecular Formula | C26H25IN2O5S |
| Molecular Weight | 604.47 g/mol |
| Exact Mass | 604.05 |
| IUPAC Name | 1-[1-[4-(4-iodophenoxy)phenyl]sulfonylpiperidin-4-yl]-6-methyl-4H-3,1-benzoxazin-2-one |
| SMILES | Cc1ccc2c(c1)COC(=O)N2C1CCN(S(=O)(=O)c2ccc(Oc3ccc(I)cc3)cc2)CC1 |
| InChI | InChI=1S/C26H25IN2O5S/c1-18-2-11-25-19(16-18)17-33-26(30)29(25)21-12-14-28(15-13-21)35(31,32)24-9-7-23(8-10-24)34-22-5-3-20(27)4-6-22/h2-11,16,21H,12-15,17H2,1H3 |
| InChIKey | QGVXUMCSASRLRU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|