C25H22BBrN2O5S — CID 89244972
CID 89244972 (PubChem CID 89244972) has the molecular formula C25H22BBrN2O5S and a molecular weight of 553.24 g/mol.
| Compound Name | CID 89244972 |
|---|---|
| PubChem CID | 89244972 |
| Molecular Formula | C25H22BBrN2O5S |
| Molecular Weight | 553.24 g/mol |
| Exact Mass | 552.05 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)COC(=O)N2C1CCN(S(=O)(=O)c2ccc(Oc3ccc(Br)cc3)cc2)CC1 |
| InChI | InChI=1S/C25H22BBrN2O5S/c26-18-1-10-24-17(15-18)16-33-25(30)29(24)20-11-13-28(14-12-20)35(31,32)23-8-6-22(7-9-23)34-21-4-2-19(27)3-5-21/h1-10,15,20H,11-14,16H2 |
| InChIKey | MLTXJFIAAIBTMY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.24 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|