C20H21BN2O4S — CID 89244969
CID 89244969 (PubChem CID 89244969) has the molecular formula C20H21BN2O4S and a molecular weight of 396.28 g/mol.
| Compound Name | CID 89244969 |
|---|---|
| PubChem CID | 89244969 |
| Molecular Formula | C20H21BN2O4S |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(S(=O)(=O)N2CCC(N3C(=O)OCc4cccc(C)c43)CC2)cc1 |
| InChI | InChI=1S/C20H21BN2O4S/c1-14-3-2-4-15-13-27-20(24)23(19(14)15)17-9-11-22(12-10-17)28(25,26)18-7-5-16(21)6-8-18/h2-8,17H,9-13H2,1H3 |
| InChIKey | BVCQFKPQUWJLKP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|