C19H19BrClN3O4S — CID 58792880
1-[1-[(5-bromo-6-chloro-3-pyridinyl)sulfonyl]piperidin-4-yl]-8-methyl-4H-3,1-benzoxazin-2-one (PubChem CID 58792880) has the molecular formula C19H19BrClN3O4S and a molecular weight of 500.80 g/mol. Its IUPAC name is 1-[1-[(5-bromo-6-chloro-3-pyridinyl)sulfonyl]piperidin-4-yl]-8-methyl-4H-3,1-benzoxazin-2-one.
| Compound Name | 1-[1-[(5-bromo-6-chloro-3-pyridinyl)sulfonyl]piperidin-4-yl]-8-methyl-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 58792880 |
| Molecular Formula | C19H19BrClN3O4S |
| Molecular Weight | 500.80 g/mol |
| Exact Mass | 499.00 |
| IUPAC Name | 1-[1-[(5-bromo-6-chloro-3-pyridinyl)sulfonyl]piperidin-4-yl]-8-methyl-4H-3,1-benzoxazin-2-one |
| SMILES | Cc1cccc2c1N(C1CCN(S(=O)(=O)c3cnc(Cl)c(Br)c3)CC1)C(=O)OC2 |
| InChI | InChI=1S/C19H19BrClN3O4S/c1-12-3-2-4-13-11-28-19(25)24(17(12)13)14-5-7-23(8-6-14)29(26,27)15-9-16(20)18(21)22-10-15/h2-4,9-10,14H,5-8,11H2,1H3 |
| InChIKey | TZVOVGJUABOZLK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.80 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|