C20H19ClF2N2O4S — CID 58792763
1-[1-(5-chloro-2,4-difluorophenyl)sulfonylpiperidin-4-yl]-8-methyl-4H-3,1-benzoxazin-2-one (PubChem CID 58792763) has the molecular formula C20H19ClF2N2O4S and a molecular weight of 456.90 g/mol. Its IUPAC name is 1-[1-(5-chloro-2,4-difluorophenyl)sulfonylpiperidin-4-yl]-8-methyl-4H-3,1-benzoxazin-2-one.
| Compound Name | 1-[1-(5-chloro-2,4-difluorophenyl)sulfonylpiperidin-4-yl]-8-methyl-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 58792763 |
| Molecular Formula | C20H19ClF2N2O4S |
| Molecular Weight | 456.90 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 1-[1-(5-chloro-2,4-difluorophenyl)sulfonylpiperidin-4-yl]-8-methyl-4H-3,1-benzoxazin-2-one |
| SMILES | Cc1cccc2c1N(C1CCN(S(=O)(=O)c3cc(Cl)c(F)cc3F)CC1)C(=O)OC2 |
| InChI | InChI=1S/C20H19ClF2N2O4S/c1-12-3-2-4-13-11-29-20(26)25(19(12)13)14-5-7-24(8-6-14)30(27,28)18-9-15(21)16(22)10-17(18)23/h2-4,9-10,14H,5-8,11H2,1H3 |
| InChIKey | CKJCUNNZXXCGJU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.90 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|