C19H18ClIN2O4S — CID 142998636
6-chloro-1-[1-(4-iodophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one (PubChem CID 142998636) has the molecular formula C19H18ClIN2O4S and a molecular weight of 532.79 g/mol. Its IUPAC name is 6-chloro-1-[1-(4-iodophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one.
| Compound Name | 6-chloro-1-[1-(4-iodophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 142998636 |
| Molecular Formula | C19H18ClIN2O4S |
| Molecular Weight | 532.79 g/mol |
| Exact Mass | 531.97 |
| IUPAC Name | 6-chloro-1-[1-(4-iodophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one |
| SMILES | O=C1OCc2cc(Cl)ccc2N1C1CCN(S(=O)(=O)c2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C19H18ClIN2O4S/c20-14-1-6-18-13(11-14)12-27-19(24)23(18)16-7-9-22(10-8-16)28(25,26)17-4-2-15(21)3-5-17/h1-6,11,16H,7-10,12H2 |
| InChIKey | SPUIYXWILIUMJT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.79 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|