C20H19ClN2O6S — CID 142998166
2-[4-(6-chloro-2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]sulfonylbenzoic acid (PubChem CID 142998166) has the molecular formula C20H19ClN2O6S and a molecular weight of 450.90 g/mol. Its IUPAC name is 2-[4-(6-chloro-2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 2-[4-(6-chloro-2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 142998166 |
| Molecular Formula | C20H19ClN2O6S |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 2-[4-(6-chloro-2-oxo-4H-3,1-benzoxazin-1-yl)piperidin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1ccccc1S(=O)(=O)N1CCC(N2C(=O)OCc3cc(Cl)ccc32)CC1 |
| InChI | InChI=1S/C20H19ClN2O6S/c21-14-5-6-17-13(11-14)12-29-20(26)23(17)15-7-9-22(10-8-15)30(27,28)18-4-2-1-3-16(18)19(24)25/h1-6,11,15H,7-10,12H2,(H,24,25) |
| InChIKey | NKCQUFBLWDXDIP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |