C23H23N3O4S — CID 89125963
6-amino-1-(1-naphthalen-1-ylsulfonylpiperidin-4-yl)-4H-3,1-benzoxazin-2-one (PubChem CID 89125963) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is 6-amino-1-(1-naphthalen-1-ylsulfonylpiperidin-4-yl)-4H-3,1-benzoxazin-2-one.
| Compound Name | 6-amino-1-(1-naphthalen-1-ylsulfonylpiperidin-4-yl)-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 89125963 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 6-amino-1-(1-naphthalen-1-ylsulfonylpiperidin-4-yl)-4H-3,1-benzoxazin-2-one |
| SMILES | Nc1ccc2c(c1)COC(=O)N2C1CCN(S(=O)(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C23H23N3O4S/c24-18-8-9-21-17(14-18)15-30-23(27)26(21)19-10-12-25(13-11-19)31(28,29)22-7-3-5-16-4-1-2-6-20(16)22/h1-9,14,19H,10-13,15,24H2 |
| InChIKey | QNFVUQHAWCOIHH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|