C18H19N3O5S — CID 17122993
2-(2-ethoxyethoxy)-N-[(4-nitrophenyl)carbamothioyl]benzamide (PubChem CID 17122993) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)-N-[(4-nitrophenyl)carbamothioyl]benzamide.
| Compound Name | 2-(2-ethoxyethoxy)-N-[(4-nitrophenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17122993 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-(2-ethoxyethoxy)-N-[(4-nitrophenyl)carbamothioyl]benzamide |
| SMILES | CCOCCOc1ccccc1C(=O)NC(=S)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19N3O5S/c1-2-25-11-12-26-16-6-4-3-5-15(16)17(22)20-18(27)19-13-7-9-14(10-8-13)21(23)24/h3-10H,2,11-12H2,1H3,(H2,19,20,22,27) |
| InChIKey | XVXWYMGEANQFFJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|