C17H16ClN3O5S — CID 17355898
N-[(4-chloro-3-nitrophenyl)carbamothioyl]-2-(2-methoxyethoxy)benzamide (PubChem CID 17355898) has the molecular formula C17H16ClN3O5S and a molecular weight of 409.85 g/mol. Its IUPAC name is N-[(4-chloro-3-nitrophenyl)carbamothioyl]-2-(2-methoxyethoxy)benzamide.
| Compound Name | N-[(4-chloro-3-nitrophenyl)carbamothioyl]-2-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17355898 |
| Molecular Formula | C17H16ClN3O5S |
| Molecular Weight | 409.85 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | N-[(4-chloro-3-nitrophenyl)carbamothioyl]-2-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccccc1C(=O)NC(=S)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16ClN3O5S/c1-25-8-9-26-15-5-3-2-4-12(15)16(22)20-17(27)19-11-6-7-13(18)14(10-11)21(23)24/h2-7,10H,8-9H2,1H3,(H2,19,20,22,27) |
| InChIKey | CQKMZMDJNKNLBV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.85 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|