C14H16ClN3O6S — CID 17338793
2-methoxyethyl 4-[(4-chloro-3-nitrophenyl)carbamothioylamino]-4-oxobutanoate (PubChem CID 17338793) has the molecular formula C14H16ClN3O6S and a molecular weight of 389.82 g/mol. Its IUPAC name is 2-methoxyethyl 4-[(4-chloro-3-nitrophenyl)carbamothioylamino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[(4-chloro-3-nitrophenyl)carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17338793 |
| Molecular Formula | C14H16ClN3O6S |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 2-methoxyethyl 4-[(4-chloro-3-nitrophenyl)carbamothioylamino]-4-oxobutanoate |
| SMILES | COCCOC(=O)CCC(=O)NC(=S)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H16ClN3O6S/c1-23-6-7-24-13(20)5-4-12(19)17-14(25)16-9-2-3-10(15)11(8-9)18(21)22/h2-3,8H,4-7H2,1H3,(H2,16,17,19,25) |
| InChIKey | ZINPIOKTHHIMGV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|