C16H20ClN3O3S — CID 4934261
N-[(4-chloro-3-nitrophenyl)carbamothioyl]-3-cyclohexylpropanamide (PubChem CID 4934261) has the molecular formula C16H20ClN3O3S and a molecular weight of 369.87 g/mol. Its IUPAC name is N-[(4-chloro-3-nitrophenyl)carbamothioyl]-3-cyclohexylpropanamide.
| Compound Name | N-[(4-chloro-3-nitrophenyl)carbamothioyl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 4934261 |
| Molecular Formula | C16H20ClN3O3S |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | N-[(4-chloro-3-nitrophenyl)carbamothioyl]-3-cyclohexylpropanamide |
| SMILES | O=C(CCC1CCCCC1)NC(=S)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H20ClN3O3S/c17-13-8-7-12(10-14(13)20(22)23)18-16(24)19-15(21)9-6-11-4-2-1-3-5-11/h7-8,10-11H,1-6,9H2,(H2,18,19,21,24) |
| InChIKey | IJWXNFVUVQORLV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|