C36H40N4O4S2 — CID 4947253
N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-2-pentoxybenzamide (PubChem CID 4947253) has the molecular formula C36H40N4O4S2 and a molecular weight of 656.87 g/mol. Its IUPAC name is N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-2-pentoxybenzamide.
| Compound Name | N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-2-pentoxybenzamide |
|---|---|
| PubChem CID | 4947253 |
| Molecular Formula | C36H40N4O4S2 |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 656.25 |
| IUPAC Name | N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-2-pentoxybenzamide |
| SMILES | CCCCCOc1ccccc1C(=O)NC(=S)Nc1ccc(S(=O)(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C36H40N4O4S2/c1-2-3-12-27-44-33-18-11-10-17-32(33)35(41)38-36(45)37-30-19-21-31(22-20-30)46(42,43)40-25-23-39(24-26-40)34(28-13-6-4-7-14-28)29-15-8-5-9-16-29/h4-11,13-22,34H,2-3,12,23-27H2,1H3,(H2,37,38,41,45) |
| InChIKey | ZQHDTZXYPSTGQR-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|