C24H24N2O4S — CID 42505329
(2S)-N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-2-(2-methylphenoxy)propanamide (PubChem CID 42505329) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is (2S)-N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-2-(2-methylphenoxy)propanamide.
| Compound Name | (2S)-N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-2-(2-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 42505329 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (2S)-N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-2-(2-methylphenoxy)propanamide |
| SMILES | Cc1ccccc1O[C@@H](C)C(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C24H24N2O4S/c1-17-7-3-6-10-23(17)30-18(2)24(27)25-20-11-13-21(14-12-20)31(28,29)26-16-15-19-8-4-5-9-22(19)26/h3-14,18H,15-16H2,1-2H3,(H,25,27)/t18-/m0/s1 |
| InChIKey | ZBETZEORHNMJIG-SFHVURJKSA-N |
| XLogP | 4.15 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |