C27H26N2O5S — CID 42970548
[1-(3-methylanilino)-1-oxopropan-2-yl] (E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoate (PubChem CID 42970548) has the molecular formula C27H26N2O5S and a molecular weight of 490.58 g/mol. Its IUPAC name is [1-(3-methylanilino)-1-oxopropan-2-yl] (E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoate.
| Compound Name | [1-(3-methylanilino)-1-oxopropan-2-yl] (E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 42970548 |
| Molecular Formula | C27H26N2O5S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | [1-(3-methylanilino)-1-oxopropan-2-yl] (E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoate |
| SMILES | Cc1cccc(NC(=O)C(C)OC(=O)/C=C/c2ccc(S(=O)(=O)N3CCc4ccccc43)cc2)c1 |
| InChI | InChI=1S/C27H26N2O5S/c1-19-6-5-8-23(18-19)28-27(31)20(2)34-26(30)15-12-21-10-13-24(14-11-21)35(32,33)29-17-16-22-7-3-4-9-25(22)29/h3-15,18,20H,16-17H2,1-2H3,(H,28,31)/b15-12+ |
| InChIKey | CGMHVAODBQAZQX-NTCAYCPXSA-N |
| XLogP | 4.33 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|